C25H40N4O6 — CID 18051372
tert-butyl N-[4-amino-1-[[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-propylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18051372) has the molecular formula C25H40N4O6 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-propylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-propylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18051372 |
| Molecular Formula | C25H40N4O6 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-propylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccc(O)cc1)N(CCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40N4O6/c1-6-8-9-14-27-22(32)21(17-10-12-18(30)13-11-17)29(15-7-2)23(33)19(16-20(26)31)28-24(34)35-25(3,4)5/h10-13,19,21,30H,6-9,14-16H2,1-5H3,(H2,26,31)(H,27,32)(H,28,34) |
| InChIKey | QFQQPMFHOAUGGE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|