C36H54N4O5 — CID 18066258
tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066258) has the molecular formula C36H54N4O5 and a molecular weight of 622.85 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066258 |
| Molecular Formula | C36H54N4O5 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C36H54N4O5/c1-8-10-11-12-13-14-24-40(34(43)29(22-23-30(37)41)38-35(44)45-36(5,6)7)32(28-20-18-27(9-2)19-21-28)33(42)39-31-25(3)16-15-17-26(31)4/h15-21,29,32H,8-14,22-24H2,1-7H3,(H2,37,41)(H,38,44)(H,39,42) |
| InChIKey | ZISQDDHJKQRFQM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|