C31H44N4O6 — CID 18064698
tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18064698) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18064698 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccccc1O |
| InChI | InChI=1S/C31H44N4O6/c1-7-8-11-19-35(29(39)23(17-18-25(32)37)33-30(40)41-31(4,5)6)27(22-15-9-10-16-24(22)36)28(38)34-26-20(2)13-12-14-21(26)3/h9-10,12-16,23,27,36H,7-8,11,17-19H2,1-6H3,(H2,32,37)(H,33,40)(H,34,38) |
| InChIKey | IOVXSEXIHLOVQK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|