C38H52N4O5 — CID 18066331
tert-butyl N-[5-amino-1-[[1-(3,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066331) has the molecular formula C38H52N4O5 and a molecular weight of 644.86 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(3,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(3,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066331 |
| Molecular Formula | C38H52N4O5 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(3,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C38H52N4O5/c1-7-8-9-10-11-14-23-42(36(45)32(21-22-33(39)43)41-37(46)47-38(4,5)6)34(30-18-17-26(2)27(3)24-30)35(44)40-31-20-19-28-15-12-13-16-29(28)25-31/h12-13,15-20,24-25,32,34H,7-11,14,21-23H2,1-6H3,(H2,39,43)(H,40,44)(H,41,46) |
| InChIKey | HOVSCRKLSDDFOT-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|