C32H38N4O6 — CID 18062011
tert-butyl N-[5-amino-1-[[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18062011) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18062011 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cccc(C)c1O |
| InChI | InChI=1S/C32H38N4O6/c1-6-18-36(30(40)25(16-17-26(33)37)35-31(41)42-32(3,4)5)27(24-13-9-10-20(2)28(24)38)29(39)34-23-15-14-21-11-7-8-12-22(21)19-23/h6-15,19,25,27,38H,1,16-18H2,2-5H3,(H2,33,37)(H,34,39)(H,35,41) |
| InChIKey | NJWQSAJXFIHGON-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|