C38H49N3O4S — CID 18032026
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18032026) has the molecular formula C38H49N3O4S and a molecular weight of 643.89 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18032026 |
| Molecular Formula | C38H49N3O4S |
| Molecular Weight | 643.89 g/mol |
| Exact Mass | 643.34 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccc2ccccc2c1)N(CCCCCCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H49N3O4S/c1-7-9-10-11-12-17-25-41(36(43)33(24-26-46-6)40-37(44)45-38(3,4)5)34(32-21-16-15-18-28(32)8-2)35(42)39-31-23-22-29-19-13-14-20-30(29)27-31/h2,13-16,18-23,27,33-34H,7,9-12,17,24-26H2,1,3-6H3,(H,39,42)(H,40,44) |
| InChIKey | IQUMKMKEUYBKQQ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.89 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|