C33H51N3O6S — CID 18032031
ethyl 3-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]-octylamino]acetyl]amino]propanoate (PubChem CID 18032031) has the molecular formula C33H51N3O6S and a molecular weight of 617.85 g/mol. Its IUPAC name is ethyl 3-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]-octylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]-octylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18032031 |
| Molecular Formula | C33H51N3O6S |
| Molecular Weight | 617.85 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | ethyl 3-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]-octylamino]acetyl]amino]propanoate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCC(=O)OCC)N(CCCCCCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H51N3O6S/c1-8-11-12-13-14-17-23-36(31(39)27(21-24-43-7)35-32(40)42-33(4,5)6)29(26-19-16-15-18-25(26)9-2)30(38)34-22-20-28(37)41-10-3/h2,15-16,18-19,27,29H,8,10-14,17,20-24H2,1,3-7H3,(H,34,38)(H,35,40) |
| InChIKey | KRGAKXIZYLPTRZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.85 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|