C37H51N3O7 — CID 18212323
ethyl 3-[[2-(2-ethynylphenyl)-2-[[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]-octylamino]acetyl]amino]propanoate (PubChem CID 18212323) has the molecular formula C37H51N3O7 and a molecular weight of 649.83 g/mol. Its IUPAC name is ethyl 3-[[2-(2-ethynylphenyl)-2-[[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]-octylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(2-ethynylphenyl)-2-[[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]-octylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18212323 |
| Molecular Formula | C37H51N3O7 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.37 |
| IUPAC Name | ethyl 3-[[2-(2-ethynylphenyl)-2-[[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]-octylamino]acetyl]amino]propanoate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCC(=O)OCC)N(CCCCCCCC)C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H51N3O7/c1-7-10-11-12-13-16-25-40(33(30-18-15-14-17-28(30)8-2)34(43)38-24-23-32(42)46-9-3)35(44)31(39-36(45)47-37(4,5)6)26-27-19-21-29(41)22-20-27/h2,14-15,17-22,31,33,41H,7,9-13,16,23-26H2,1,3-6H3,(H,38,43)(H,39,45) |
| InChIKey | PRMMOXNEHSQYPL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|