C34H45N3O4S — CID 18031051
tert-butyl N-[1-[hexyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18031051) has the molecular formula C34H45N3O4S and a molecular weight of 591.82 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18031051 |
| Molecular Formula | C34H45N3O4S |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C34H45N3O4S/c1-6-7-8-14-22-37(32(39)29(21-23-42-5)36-33(40)41-34(2,3)4)30(26-16-10-9-11-17-26)31(38)35-28-20-19-25-15-12-13-18-27(25)24-28/h9-13,15-20,24,29-30H,6-8,14,21-23H2,1-5H3,(H,35,38)(H,36,40) |
| InChIKey | ZLFLIEJMWVEXKE-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|