C38H51N3O5 — CID 18217826
tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217826) has the molecular formula C38H51N3O5 and a molecular weight of 629.84 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217826 |
| Molecular Formula | C38H51N3O5 |
| Molecular Weight | 629.84 g/mol |
| Exact Mass | 629.38 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1cccc(C)c1C |
| InChI | InChI=1S/C38H51N3O5/c1-8-9-10-11-15-25-41(36(43)33(26-29-18-13-12-14-19-29)40-37(44)46-38(4,5)6)34(32-20-16-17-27(2)28(32)3)35(42)39-30-21-23-31(45-7)24-22-30/h12-14,16-24,33-34H,8-11,15,25-26H2,1-7H3,(H,39,42)(H,40,44) |
| InChIKey | HUTYPKFNGWHBLN-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.84 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|