C34H43N3O6S — CID 18056255
tert-butyl 2-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate (PubChem CID 18056255) has the molecular formula C34H43N3O6S and a molecular weight of 621.80 g/mol. Its IUPAC name is tert-butyl 2-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18056255 |
| Molecular Formula | C34H43N3O6S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | tert-butyl 2-[[2-(2-ethynylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)N(CC=C)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H43N3O6S/c1-9-20-37(30(39)27(22-44)36-32(41)43-34(6,7)8)28(25-19-15-14-18-24(25)10-2)29(38)35-26(31(40)42-33(3,4)5)21-23-16-12-11-13-17-23/h2,9,11-19,26-28,44H,1,20-22H2,3-8H3,(H,35,38)(H,36,41) |
| InChIKey | GMZSQRCWUOHDCF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|