C32H43N3O7 — CID 18010550
tert-butyl 2-[[2-(2-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate (PubChem CID 18010550) has the molecular formula C32H43N3O7 and a molecular weight of 581.71 g/mol. Its IUPAC name is tert-butyl 2-[[2-(2-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-(2-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18010550 |
| Molecular Formula | C32H43N3O7 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | tert-butyl 2-[[2-(2-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-prop-2-enylamino]acetyl]amino]-3-phenylpropanoate |
| SMILES | C=CCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1ccccc1O |
| InChI | InChI=1S/C32H43N3O7/c1-9-19-35(28(38)21(2)33-30(40)42-32(6,7)8)26(23-17-13-14-18-25(23)36)27(37)34-24(29(39)41-31(3,4)5)20-22-15-11-10-12-16-22/h9-18,21,24,26,36H,1,19-20H2,2-8H3,(H,33,40)(H,34,37) |
| InChIKey | IUQKTDQLNYSAHI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|