C24H36N4O5S — CID 18027355
tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18027355) has the molecular formula C24H36N4O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18027355 |
| Molecular Formula | C24H36N4O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccccc1O)N(CC#N)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36N4O5S/c1-6-7-14-26-21(30)20(17-10-8-9-11-19(17)29)28(15-13-25)22(31)18(12-16-34-5)27-23(32)33-24(2,3)4/h8-11,18,20,29H,6-7,12,14-16H2,1-5H3,(H,26,30)(H,27,32) |
| InChIKey | HJYZWTCRIHPQKC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|