C25H38N4O4S — CID 18027400
tert-butyl N-[1-[[2-(butylamino)-1-(4-methylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18027400) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(4-methylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(4-methylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18027400 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(4-methylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccc(C)cc1)N(CC#N)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H38N4O4S/c1-7-8-15-27-22(30)21(19-11-9-18(2)10-12-19)29(16-14-26)23(31)20(13-17-34-6)28-24(32)33-25(3,4)5/h9-12,20-21H,7-8,13,15-17H2,1-6H3,(H,27,30)(H,28,32) |
| InChIKey | QWAPDAJISOHJBL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|