C26H40N4O4S — CID 18027565
tert-butyl N-[1-[[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18027565) has the molecular formula C26H40N4O4S and a molecular weight of 504.70 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18027565 |
| Molecular Formula | C26H40N4O4S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccc(C)c(C)c1)N(CC#N)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40N4O4S/c1-8-9-14-28-23(31)22(20-11-10-18(2)19(3)17-20)30(15-13-27)24(32)21(12-16-35-7)29-25(33)34-26(4,5)6/h10-11,17,21-22H,8-9,12,14-16H2,1-7H3,(H,28,31)(H,29,33) |
| InChIKey | GKGZUVFYXDDZPH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|