C25H38N4O6 — CID 18050727
tert-butyl N-[4-amino-1-[cyclopropyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18050727) has the molecular formula C25H38N4O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[cyclopropyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[cyclopropyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18050727 |
| Molecular Formula | C25H38N4O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | tert-butyl N-[4-amino-1-[cyclopropyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1O)N(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C25H38N4O6/c1-5-6-9-14-27-22(32)21(17-10-7-8-11-19(17)30)29(16-12-13-16)23(33)18(15-20(26)31)28-24(34)35-25(2,3)4/h7-8,10-11,16,18,21,30H,5-6,9,12-15H2,1-4H3,(H2,26,31)(H,27,32)(H,28,34) |
| InChIKey | SBKRVDXVHOKYJW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|