C22H33N3O5 — CID 18016525
tert-butyl N-[2-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-cyclopropylamino]-2-oxoethyl]carbamate (PubChem CID 18016525) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-cyclopropylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-cyclopropylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18016525 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl N-[2-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-cyclopropylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccccc1O)N(C(=O)CNC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C22H33N3O5/c1-5-6-13-23-20(28)19(16-9-7-8-10-17(16)26)25(15-11-12-15)18(27)14-24-21(29)30-22(2,3)4/h7-10,15,19,26H,5-6,11-14H2,1-4H3,(H,23,28)(H,24,29) |
| InChIKey | UQANPSDKAVXCJI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|