C28H45N3O7 — CID 18043042
methyl 2-[[2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]acetate (PubChem CID 18043042) has the molecular formula C28H45N3O7 and a molecular weight of 535.68 g/mol. Its IUPAC name is methyl 2-[[2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18043042 |
| Molecular Formula | C28H45N3O7 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | methyl 2-[[2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]acetate |
| SMILES | CCCCCCCN(C(=O)C(NC(=O)OC(C)(C)C)C(C)C)C(C(=O)NCC(=O)OC)c1ccccc1O |
| InChI | InChI=1S/C28H45N3O7/c1-8-9-10-11-14-17-31(26(35)23(19(2)3)30-27(36)38-28(4,5)6)24(20-15-12-13-16-21(20)32)25(34)29-18-22(33)37-7/h12-13,15-16,19,23-24,32H,8-11,14,17-18H2,1-7H3,(H,29,34)(H,30,36) |
| InChIKey | KANCTVKKBPBWJW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|