C30H51N3O5 — CID 18037632
tert-butyl N-[3-hydroxy-1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18037632) has the molecular formula C30H51N3O5 and a molecular weight of 533.75 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18037632 |
| Molecular Formula | C30H51N3O5 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | tert-butyl N-[3-hydroxy-1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccccc1C |
| InChI | InChI=1S/C30H51N3O5/c1-7-9-11-12-13-17-21-33(28(36)25(22-34)32-29(37)38-30(4,5)6)26(24-19-15-14-18-23(24)3)27(35)31-20-16-10-8-2/h14-15,18-19,25-26,34H,7-13,16-17,20-22H2,1-6H3,(H,31,35)(H,32,37) |
| InChIKey | VLUAOURGOKCHGN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|