C28H43N3O4 — CID 18041425
tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18041425) has the molecular formula C28H43N3O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18041425 |
| Molecular Formula | C28H43N3O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCC)N(CCCC)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C28H43N3O4/c1-9-12-18-29-25(32)24(22-17-15-14-16-21(22)11-3)31(19-13-10-2)26(33)23(20(4)5)30-27(34)35-28(6,7)8/h3,14-17,20,23-24H,9-10,12-13,18-19H2,1-2,4-8H3,(H,29,32)(H,30,34) |
| InChIKey | QGDJJBRQZDKJAC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|