C26H35N3O4 — CID 18038575
tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18038575) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18038575 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCC)N(C#C)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C26H35N3O4/c1-9-12-17-27-23(30)22(20-16-14-13-15-19(20)10-2)29(11-3)24(31)21(18(4)5)28-25(32)33-26(6,7)8/h2-3,13-16,18,21-22H,9,12,17H2,1,4-8H3,(H,27,30)(H,28,32) |
| InChIKey | VRLMASISUMEZMC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|