C30H35N3O4 — CID 18038583
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18038583) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18038583 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1c(C)cccc1C)N(C#C)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C30H35N3O4/c1-10-22-17-12-13-18-23(22)26(27(34)31-25-20(5)15-14-16-21(25)6)33(11-2)28(35)24(19(3)4)32-29(36)37-30(7,8)9/h1-2,12-19,24,26H,3-9H3,(H,31,34)(H,32,36) |
| InChIKey | BNSYRAKYFXSWDV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|