C36H51N3O4 — CID 18043428
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18043428) has the molecular formula C36H51N3O4 and a molecular weight of 589.82 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18043428 |
| Molecular Formula | C36H51N3O4 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.39 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1c(C)cccc1C)N(CCCCCCCC)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C36H51N3O4/c1-10-12-13-14-15-18-24-39(34(41)30(25(3)4)38-35(42)43-36(7,8)9)32(29-23-17-16-22-28(29)11-2)33(40)37-31-26(5)20-19-21-27(31)6/h2,16-17,19-23,25,30,32H,10,12-15,18,24H2,1,3-9H3,(H,37,40)(H,38,42) |
| InChIKey | OURWLNCPGMMCDV-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|