C27H29N3O4 — CID 18015783
tert-butyl N-[2-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate (PubChem CID 18015783) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015783 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | tert-butyl N-[2-[[2-(2,6-dimethylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1c(C)cccc1C)N(C#C)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H29N3O4/c1-8-20-15-10-11-16-21(20)24(25(32)29-23-18(3)13-12-14-19(23)4)30(9-2)22(31)17-28-26(33)34-27(5,6)7/h1-2,10-16,24H,17H2,3-7H3,(H,28,33)(H,29,32) |
| InChIKey | UYNJPODXVCYEQR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|