C23H31N3O7 — CID 18015846
ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate (PubChem CID 18015846) has the molecular formula C23H31N3O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18015846 |
| Molecular Formula | C23H31N3O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate |
| SMILES | C#CN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1cccc(C)c1O |
| InChI | InChI=1S/C23H31N3O7/c1-7-26(17(27)14-25-22(31)33-23(4,5)6)19(16-11-9-10-15(3)20(16)29)21(30)24-13-12-18(28)32-8-2/h1,9-11,19,29H,8,12-14H2,2-6H3,(H,24,30)(H,25,31) |
| InChIKey | WUXNGRROZQXBLY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|