C30H37N3O8 — CID 18067146
ethyl 3-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate (PubChem CID 18067146) has the molecular formula C30H37N3O8 and a molecular weight of 567.64 g/mol. Its IUPAC name is ethyl 3-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18067146 |
| Molecular Formula | C30H37N3O8 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | ethyl 3-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]propanoate |
| SMILES | C#CN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1cccc(C)c1O |
| InChI | InChI=1S/C30H37N3O8/c1-7-33(25(22-11-9-10-19(3)26(22)36)27(37)31-17-16-24(35)40-8-2)28(38)23(32-29(39)41-30(4,5)6)18-20-12-14-21(34)15-13-20/h1,9-15,23,25,34,36H,8,16-18H2,2-6H3,(H,31,37)(H,32,39) |
| InChIKey | MXLYOVFXUSMFKK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|