C28H33N3O8 — CID 18067147
methyl 2-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]acetate (PubChem CID 18067147) has the molecular formula C28H33N3O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is methyl 2-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18067147 |
| Molecular Formula | C28H33N3O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | methyl 2-[[2-[ethynyl-[3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]acetate |
| SMILES | C#CN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1cccc(C)c1O |
| InChI | InChI=1S/C28H33N3O8/c1-7-31(23(25(35)29-16-22(33)38-6)20-10-8-9-17(2)24(20)34)26(36)21(30-27(37)39-28(3,4)5)15-18-11-13-19(32)14-12-18/h1,8-14,21,23,32,34H,15-16H2,2-6H3,(H,29,35)(H,30,37) |
| InChIKey | GMHSKNXTSSZLQT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|