C29H35N3O7 — CID 18213073
ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]propanoate (PubChem CID 18213073) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18213073 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]propanoate |
| SMILES | C#CN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1ccccc1O |
| InChI | InChI=1S/C29H35N3O7/c1-6-32(25(21-15-11-12-16-23(21)33)26(35)30-18-17-24(34)38-7-2)27(36)22(19-20-13-9-8-10-14-20)31-28(37)39-29(3,4)5/h1,8-16,22,25,33H,7,17-19H2,2-5H3,(H,30,35)(H,31,37) |
| InChIKey | IGUIRWCDTSSFMS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|