C31H33N3O5 — CID 18213066
tert-butyl N-[1-[[2-(benzylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18213066) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18213066 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C31H33N3O5/c1-5-34(29(37)25(20-22-14-8-6-9-15-22)33-30(38)39-31(2,3)4)27(24-18-12-13-19-26(24)35)28(36)32-21-23-16-10-7-11-17-23/h1,6-19,25,27,35H,20-21H2,2-4H3,(H,32,36)(H,33,38) |
| InChIKey | OWJJABIPEWMKCI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|