C31H33N3O4 — CID 18213051
tert-butyl N-[1-[[2-(benzylamino)-2-oxo-1-phenylethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18213051) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-2-oxo-1-phenylethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-2-oxo-1-phenylethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18213051 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-2-oxo-1-phenylethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33N3O4/c1-5-34(27(25-19-13-8-14-20-25)28(35)32-22-24-17-11-7-12-18-24)29(36)26(21-23-15-9-6-10-16-23)33-30(37)38-31(2,3)4/h1,6-20,26-27H,21-22H2,2-4H3,(H,32,35)(H,33,37) |
| InChIKey | FWZSNULBHVQOAB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|