C31H39N3O6S — CID 18055565
tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate (PubChem CID 18055565) has the molecular formula C31H39N3O6S and a molecular weight of 581.74 g/mol. Its IUPAC name is tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18055565 |
| Molecular Formula | C31H39N3O6S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate |
| SMILES | C#CN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C31H39N3O6S/c1-8-34(27(36)24(20-41)33-29(38)40-31(5,6)7)25(22-17-13-10-14-18-22)26(35)32-23(28(37)39-30(2,3)4)19-21-15-11-9-12-16-21/h1,9-18,23-25,41H,19-20H2,2-7H3,(H,32,35)(H,33,38) |
| InChIKey | GTKYVEXGLYDNIM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|