C37H43N3O6 — CID 18213057
tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate (PubChem CID 18213057) has the molecular formula C37H43N3O6 and a molecular weight of 625.77 g/mol. Its IUPAC name is tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18213057 |
| Molecular Formula | C37H43N3O6 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-3-phenylpropanoate |
| SMILES | C#CN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C37H43N3O6/c1-8-40(33(42)29(24-26-18-12-9-13-19-26)39-35(44)46-37(5,6)7)31(28-22-16-11-17-23-28)32(41)38-30(34(43)45-36(2,3)4)25-27-20-14-10-15-21-27/h1,9-23,29-31H,24-25H2,2-7H3,(H,38,41)(H,39,44) |
| InChIKey | WGRXNUUNOYBJOO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|