C34H33N3O4 — CID 18213053
tert-butyl N-[1-[ethynyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18213053) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18213053 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C34H33N3O4/c1-5-37(32(39)29(22-24-14-8-6-9-15-24)36-33(40)41-34(2,3)4)30(26-17-10-7-11-18-26)31(38)35-28-21-20-25-16-12-13-19-27(25)23-28/h1,6-21,23,29-30H,22H2,2-4H3,(H,35,38)(H,36,40) |
| InChIKey | YFWMOMPLRQXGNF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|