C33H43N3O7S — CID 18027080
tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]-3-phenylpropanoate (PubChem CID 18027080) has the molecular formula C33H43N3O7S and a molecular weight of 625.79 g/mol. Its IUPAC name is tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18027080 |
| Molecular Formula | C33H43N3O7S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-2-(2-hydroxyphenyl)acetyl]amino]-3-phenylpropanoate |
| SMILES | C#CN(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1ccccc1O |
| InChI | InChI=1S/C33H43N3O7S/c1-9-36(29(39)24(19-20-44-8)35-31(41)43-33(5,6)7)27(23-17-13-14-18-26(23)37)28(38)34-25(30(40)42-32(2,3)4)21-22-15-11-10-12-16-22/h1,10-18,24-25,27,37H,19-21H2,2-8H3,(H,34,38)(H,35,41) |
| InChIKey | AJMJBSNZPGGXLN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|