C24H32N4O7 — CID 18049866
ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-ethynylamino]-2-phenylacetyl]amino]propanoate (PubChem CID 18049866) has the molecular formula C24H32N4O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-ethynylamino]-2-phenylacetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-ethynylamino]-2-phenylacetyl]amino]propanoate |
|---|---|
| PubChem CID | 18049866 |
| Molecular Formula | C24H32N4O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-ethynylamino]-2-phenylacetyl]amino]propanoate |
| SMILES | C#CN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C24H32N4O7/c1-6-28(22(32)17(15-18(25)29)27-23(33)35-24(3,4)5)20(16-11-9-8-10-12-16)21(31)26-14-13-19(30)34-7-2/h1,8-12,17,20H,7,13-15H2,2-5H3,(H2,25,29)(H,26,31)(H,27,33) |
| InChIKey | JUSILBLGCOUDRK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|