C25H35N3O7 — CID 18032916
ethyl 3-[[2-(4-ethylphenyl)-2-[ethynyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoate (PubChem CID 18032916) has the molecular formula C25H35N3O7 and a molecular weight of 489.57 g/mol. Its IUPAC name is ethyl 3-[[2-(4-ethylphenyl)-2-[ethynyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(4-ethylphenyl)-2-[ethynyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18032916 |
| Molecular Formula | C25H35N3O7 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | ethyl 3-[[2-(4-ethylphenyl)-2-[ethynyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoate |
| SMILES | C#CN(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H35N3O7/c1-7-17-10-12-18(13-11-17)21(22(31)26-15-14-20(30)34-9-3)28(8-2)23(32)19(16-29)27-24(33)35-25(4,5)6/h2,10-13,19,21,29H,7,9,14-16H2,1,3-6H3,(H,26,31)(H,27,33) |
| InChIKey | HHCIFZIAEHZHLD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|