C27H32N4O5 — CID 18049863
tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18049863) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18049863 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccccc1 |
| InChI | InChI=1S/C27H32N4O5/c1-7-31(25(34)20(16-21(28)32)29-26(35)36-27(4,5)6)23(19-14-9-8-10-15-19)24(33)30-22-17(2)12-11-13-18(22)3/h1,8-15,20,23H,16H2,2-6H3,(H2,28,32)(H,29,35)(H,30,33) |
| InChIKey | DNJMBOUCKCPYDF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|