C33H37N3O4 — CID 18213115
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-methylphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18213115) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-methylphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-methylphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18213115 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-methylphenyl)-2-oxoethyl]-ethynylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H37N3O4/c1-8-36(31(38)27(21-25-15-10-9-11-16-25)34-32(39)40-33(5,6)7)29(26-19-17-22(2)18-20-26)30(37)35-28-23(3)13-12-14-24(28)4/h1,9-20,27,29H,21H2,2-7H3,(H,34,39)(H,35,37) |
| InChIKey | QYMXMQDKLMWNSF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|