C25H31N3O4 — CID 18015778
tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate (PubChem CID 18015778) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015778 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC1CCCCC1)N(C#C)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31N3O4/c1-6-18-13-11-12-16-20(18)22(23(30)27-19-14-9-8-10-15-19)28(7-2)21(29)17-26-24(31)32-25(3,4)5/h1-2,11-13,16,19,22H,8-10,14-15,17H2,3-5H3,(H,26,31)(H,27,30) |
| InChIKey | NWYGGJKGLQUCCL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|