C24H33N3O4 — CID 18015208
tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-methylamino]-2-oxoethyl]carbamate (PubChem CID 18015208) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015208 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-methylamino]-2-oxoethyl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC1CCCCC1)N(C)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H33N3O4/c1-6-17-12-10-11-15-19(17)21(22(29)26-18-13-8-7-9-14-18)27(5)20(28)16-25-23(30)31-24(2,3)4/h1,10-12,15,18,21H,7-9,13-14,16H2,2-5H3,(H,25,30)(H,26,29) |
| InChIKey | FKCGGOGLFOZJQH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|