C27H43N3O4 — CID 18019108
tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate (PubChem CID 18019108) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019108 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccccc1C |
| InChI | InChI=1S/C27H43N3O4/c1-6-7-13-18-30(23(31)19-28-26(33)34-27(3,4)5)24(22-17-12-11-14-20(22)2)25(32)29-21-15-9-8-10-16-21/h11-12,14,17,21,24H,6-10,13,15-16,18-19H2,1-5H3,(H,28,33)(H,29,32) |
| InChIKey | VXXPFPDCQUGDLB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|