C30H43N3O4 — CID 18020249
tert-butyl N-[2-[[2-(benzylamino)-1-(2-methylphenyl)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate (PubChem CID 18020249) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(benzylamino)-1-(2-methylphenyl)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(benzylamino)-1-(2-methylphenyl)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020249 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | tert-butyl N-[2-[[2-(benzylamino)-1-(2-methylphenyl)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C30H43N3O4/c1-6-7-8-9-15-20-33(26(34)22-32-29(36)37-30(3,4)5)27(25-19-14-13-16-23(25)2)28(35)31-21-24-17-11-10-12-18-24/h10-14,16-19,27H,6-9,15,20-22H2,1-5H3,(H,31,35)(H,32,36) |
| InChIKey | JBIDQQDBWSRWSG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|