C28H38ClN3O4 — CID 18019112
tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate (PubChem CID 18019112) has the molecular formula C28H38ClN3O4 and a molecular weight of 516.08 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019112 |
| Molecular Formula | C28H38ClN3O4 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1ccccc1C |
| InChI | InChI=1S/C28H38ClN3O4/c1-7-8-11-17-32(23(33)18-30-27(35)36-28(4,5)6)25(21-15-10-9-13-19(21)2)26(34)31-24-20(3)14-12-16-22(24)29/h9-10,12-16,25H,7-8,11,17-18H2,1-6H3,(H,30,35)(H,31,34) |
| InChIKey | HAJMDAXJGWISJQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|