C30H42ClN3O5 — CID 18020522
tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate (PubChem CID 18020522) has the molecular formula C30H42ClN3O5 and a molecular weight of 560.14 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020522 |
| Molecular Formula | C30H42ClN3O5 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1ccccc1O |
| InChI | InChI=1S/C30H42ClN3O5/c1-6-7-8-9-10-13-19-34(25(36)20-32-29(38)39-30(3,4)5)27(22-16-11-12-18-24(22)35)28(37)33-26-21(2)15-14-17-23(26)31/h11-12,14-18,27,35H,6-10,13,19-20H2,1-5H3,(H,32,38)(H,33,37) |
| InChIKey | GXEZFDHDVADRRL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|