C28H47N3O5 — CID 18020397
tert-butyl N-[2-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18020397) has the molecular formula C28H47N3O5 and a molecular weight of 505.70 g/mol. Its IUPAC name is tert-butyl N-[2-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020397 |
| Molecular Formula | C28H47N3O5 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | tert-butyl N-[2-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1cccc(C)c1O |
| InChI | InChI=1S/C28H47N3O5/c1-7-9-11-12-14-19-31(23(32)20-30-27(35)36-28(4,5)6)24(26(34)29-18-13-10-8-2)22-17-15-16-21(3)25(22)33/h15-17,24,33H,7-14,18-20H2,1-6H3,(H,29,34)(H,30,35) |
| InChIKey | DGQOHCDPZIGADX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|