C24H30ClN3O5 — CID 18015392
tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate (PubChem CID 18015392) has the molecular formula C24H30ClN3O5 and a molecular weight of 475.97 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015392 |
| Molecular Formula | C24H30ClN3O5 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | tert-butyl N-[2-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate |
| SMILES | CCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1ccccc1O |
| InChI | InChI=1S/C24H30ClN3O5/c1-6-28(19(30)14-26-23(32)33-24(3,4)5)21(16-11-7-8-13-18(16)29)22(31)27-20-15(2)10-9-12-17(20)25/h7-13,21,29H,6,14H2,1-5H3,(H,26,32)(H,27,31) |
| InChIKey | WOMDCVGOIPGMTN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|