C27H39N3O6 — CID 18020347
methyl 2-[[2-(2-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetate (PubChem CID 18020347) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is methyl 2-[[2-(2-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18020347 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | methyl 2-[[2-(2-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetate |
| SMILES | C#Cc1ccccc1C(C(=O)NCC(=O)OC)N(CCCCCCC)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H39N3O6/c1-7-9-10-11-14-17-30(22(31)18-29-26(34)36-27(3,4)5)24(25(33)28-19-23(32)35-6)21-16-13-12-15-20(21)8-2/h2,12-13,15-16,24H,7,9-11,14,17-19H2,1,3-6H3,(H,28,33)(H,29,34) |
| InChIKey | LOKCSGZTIZRHGZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|