C31H39N3O6 — CID 18015695
tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]-3-phenylpropanoate (PubChem CID 18015695) has the molecular formula C31H39N3O6 and a molecular weight of 549.67 g/mol. Its IUPAC name is tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18015695 |
| Molecular Formula | C31H39N3O6 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | tert-butyl 2-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]-3-phenylpropanoate |
| SMILES | C#CN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1ccccc1C |
| InChI | InChI=1S/C31H39N3O6/c1-9-34(25(35)20-32-29(38)40-31(6,7)8)26(23-18-14-13-15-21(23)2)27(36)33-24(28(37)39-30(3,4)5)19-22-16-11-10-12-17-22/h1,10-18,24,26H,19-20H2,2-8H3,(H,32,38)(H,33,36) |
| InChIKey | HUOYCLXSAWKWGL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|