C22H31ClN2O3 — CID 86809846
2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide (PubChem CID 86809846) has the molecular formula C22H31ClN2O3 and a molecular weight of 406.95 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86809846 |
| Molecular Formula | C22H31ClN2O3 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1C(C(=O)NC1CCCCC1)N(CC1CCCO1)C(=O)CCl |
| InChI | InChI=1S/C22H31ClN2O3/c1-16-8-5-6-12-19(16)21(22(27)24-17-9-3-2-4-10-17)25(20(26)14-23)15-18-11-7-13-28-18/h5-6,8,12,17-18,21H,2-4,7,9-11,13-15H2,1H3,(H,24,27) |
| InChIKey | XPYJRXISECXVPD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|