C22H29ClN2O2 — CID 123415010
2-[(2-chloroacetyl)-penta-1,3-dien-3-ylamino]-N-cyclohexyl-2-(2-methylphenyl)acetamide (PubChem CID 123415010) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-penta-1,3-dien-3-ylamino]-N-cyclohexyl-2-(2-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-penta-1,3-dien-3-ylamino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 123415010 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[(2-chloroacetyl)-penta-1,3-dien-3-ylamino]-N-cyclohexyl-2-(2-methylphenyl)acetamide |
| SMILES | C=CC(=CC)N(C(=O)CCl)C(C(=O)NC1CCCCC1)c1ccccc1C |
| InChI | InChI=1S/C22H29ClN2O2/c1-4-18(5-2)25(20(26)15-23)21(19-14-10-9-11-16(19)3)22(27)24-17-12-7-6-8-13-17/h4-5,9-11,14,17,21H,1,6-8,12-13,15H2,2-3H3,(H,24,27) |
| InChIKey | PQJAUTBIFYUXRT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|